C11H18OSi — CID 130831903
(1S,4S)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol (PubChem CID 130831903) has the molecular formula C11H18OSi and a molecular weight of 194.35 g/mol. Its IUPAC name is (1S,4S)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4S)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 130831903 |
| Molecular Formula | C11H18OSi |
| Molecular Weight | 194.35 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (1S,4S)-4-(3-trimethylsilylprop-2-ynyl)cyclopent-2-en-1-ol |
| SMILES | C[Si](C)(C)C#CC[C@@H]1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C11H18OSi/c1-13(2,3)8-4-5-10-6-7-11(12)9-10/h6-7,10-12H,5,9H2,1-3H3/t10-,11-/m1/s1 |
| InChIKey | RLUWMFSPVMADJD-GHMZBOCLSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|