C21H32O2Si — CID 14985556
9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol (PubChem CID 14985556) has the molecular formula C21H32O2Si and a molecular weight of 344.57 g/mol. Its IUPAC name is 9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol.
| Compound Name | 9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol |
|---|---|
| PubChem CID | 14985556 |
| Molecular Formula | C21H32O2Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol |
| SMILES | CC[Si](CC)(CC)OC1C#CCC2(O)CCC=C2C#CC(C)(C)C1 |
| InChI | InChI=1S/C21H32O2Si/c1-6-24(7-2,8-3)23-19-12-10-15-21(22)14-9-11-18(21)13-16-20(4,5)17-19/h11,19,22H,6-9,14-15,17H2,1-5H3 |
| InChIKey | WHOSDHGQXGGJFX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|