C29H50O3Si2 — CID 139755705
9,9-dimethyl-7-triethylsilyloxy-2-(2-triethylsilyloxyethyl)-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol (PubChem CID 139755705) has the molecular formula C29H50O3Si2 and a molecular weight of 502.89 g/mol. Its IUPAC name is 9,9-dimethyl-7-triethylsilyloxy-2-(2-triethylsilyloxyethyl)-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol.
| Compound Name | 9,9-dimethyl-7-triethylsilyloxy-2-(2-triethylsilyloxyethyl)-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol |
|---|---|
| PubChem CID | 139755705 |
| Molecular Formula | C29H50O3Si2 |
| Molecular Weight | 502.89 g/mol |
| Exact Mass | 502.33 |
| IUPAC Name | 9,9-dimethyl-7-triethylsilyloxy-2-(2-triethylsilyloxyethyl)-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol |
| SMILES | CC[Si](CC)(CC)OCCC1C=C2C#CC(C)(C)CC(O[Si](CC)(CC)CC)C#CCC2(O)C1 |
| InChI | InChI=1S/C29H50O3Si2/c1-9-33(10-2,11-3)31-21-18-25-22-26-17-20-28(7,8)24-27(16-15-19-29(26,30)23-25)32-34(12-4,13-5)14-6/h22,25,27,30H,9-14,18-19,21,23-24H2,1-8H3 |
| InChIKey | QGOKBMWYKIBZHT-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.89 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|