C27H46O3Si2 — CID 15233711
2-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol (PubChem CID 15233711) has the molecular formula C27H46O3Si2 and a molecular weight of 474.83 g/mol. Its IUPAC name is 2-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol.
| Compound Name | 2-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol |
|---|---|
| PubChem CID | 15233711 |
| Molecular Formula | C27H46O3Si2 |
| Molecular Weight | 474.83 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | 2-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyl-7-triethylsilyloxy-5,6,10,11-tetradehydro-3,4,7,8-tetrahydro-2H-cyclopenta[10]annulen-3a-ol |
| SMILES | CC[Si](CC)(CC)OC1C#CCC2(O)CC(O[Si](C)(C)C(C)(C)C)C=C2C#CC(C)(C)C1 |
| InChI | InChI=1S/C27H46O3Si2/c1-11-32(12-2,13-3)30-23-15-14-17-27(28)21-24(29-31(9,10)25(4,5)6)19-22(27)16-18-26(7,8)20-23/h19,23-24,28H,11-13,17,20-21H2,1-10H3 |
| InChIKey | KOJAUDIWBXACNU-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.83 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|