C30H52O4Si3 — CID 139616252
(1S,2R,6Z)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-12a-trimethylsilyloxy-4,5,10,11-tetradehydro-2,8,9,12-tetrahydro-1H-cyclopenta[11]annulen-9-ol (PubChem CID 139616252) has the molecular formula C30H52O4Si3 and a molecular weight of 561.00 g/mol. Its IUPAC name is (1S,2R,6Z)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-12a-trimethylsilyloxy-4,5,10,11-tetradehydro-2,8,9,12-tetrahydro-1H-cyclopenta[11]annulen-9-ol.
| Compound Name | (1S,2R,6Z)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-12a-trimethylsilyloxy-4,5,10,11-tetradehydro-2,8,9,12-tetrahydro-1H-cyclopenta[11]annulen-9-ol |
|---|---|
| PubChem CID | 139616252 |
| Molecular Formula | C30H52O4Si3 |
| Molecular Weight | 561.00 g/mol |
| Exact Mass | 560.32 |
| IUPAC Name | (1S,2R,6Z)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methyl-12a-trimethylsilyloxy-4,5,10,11-tetradehydro-2,8,9,12-tetrahydro-1H-cyclopenta[11]annulen-9-ol |
| SMILES | C/C1=C/CC(O)C#CCC2(O[Si](C)(C)C)C(=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)C#C1 |
| InChI | InChI=1S/C30H52O4Si3/c1-23-17-19-24-22-26(32-36(11,12)28(2,3)4)27(33-37(13,14)29(5,6)7)30(24,34-35(8,9)10)21-15-16-25(31)20-18-23/h18,22,25-27,31H,20-21H2,1-14H3/b23-18-/t25?,26-,27+,30?/m1/s1 |
| InChIKey | ZNABPXDWYWJZSY-QQSFFSNPSA-N |
| XLogP | 7.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.00 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|