C33H58O4Si3 — CID 134976996
(1S,2R,6R,7S)-1,2,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethenyl-6-methyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol (PubChem CID 134976996) has the molecular formula C33H58O4Si3 and a molecular weight of 603.08 g/mol. Its IUPAC name is (1S,2R,6R,7S)-1,2,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethenyl-6-methyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol.
| Compound Name | (1S,2R,6R,7S)-1,2,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethenyl-6-methyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol |
|---|---|
| PubChem CID | 134976996 |
| Molecular Formula | C33H58O4Si3 |
| Molecular Weight | 603.08 g/mol |
| Exact Mass | 602.36 |
| IUPAC Name | (1S,2R,6R,7S)-1,2,10a-tris[[tert-butyl(dimethyl)silyl]oxy]-6-ethenyl-6-methyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-7-ol |
| SMILES | C=C[C@]1(C)C#CC2=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C2(O[Si](C)(C)C(C)(C)C)CC#C[C@@H]1O |
| InChI | InChI=1S/C33H58O4Si3/c1-18-32(11)23-21-25-24-26(35-38(12,13)29(2,3)4)28(36-39(14,15)30(5,6)7)33(25,22-19-20-27(32)34)37-40(16,17)31(8,9)10/h18,24,26-28,34H,1,22H2,2-17H3/t26-,27+,28+,32-,33?/m1/s1 |
| InChIKey | VZHOZFFVLQSQSI-LZDDKWETSA-N |
| XLogP | 8.43 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.08 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|