C25H46O3Si3 — CID 11016297
(1S,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-prop-2-ynyl-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol (PubChem CID 11016297) has the molecular formula C25H46O3Si3 and a molecular weight of 478.90 g/mol. Its IUPAC name is (1S,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-prop-2-ynyl-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-prop-2-ynyl-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11016297 |
| Molecular Formula | C25H46O3Si3 |
| Molecular Weight | 478.90 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (1S,4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-prop-2-ynyl-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
| SMILES | C#CC[C@]1(O)C(C#C[Si](C)(C)C)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H46O3Si3/c1-15-17-25(26)20(16-18-29(8,9)10)19-21(27-30(11,12)23(2,3)4)22(25)28-31(13,14)24(5,6)7/h1,19,21-22,26H,17H2,2-14H3/t21-,22+,25+/m1/s1 |
| InChIKey | KAVLIPUZSWQPCF-SLSDLSHTSA-N |
| XLogP | 6.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.90 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|