C21H30O4Si — CID 139616238
(8Z,14R,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyne-1,14-diol (PubChem CID 139616238) has the molecular formula C21H30O4Si and a molecular weight of 374.55 g/mol. Its IUPAC name is (8Z,14R,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyne-1,14-diol.
| Compound Name | (8Z,14R,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyne-1,14-diol |
|---|---|
| PubChem CID | 139616238 |
| Molecular Formula | C21H30O4Si |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | (8Z,14R,15S)-15-[tert-butyl(dimethyl)silyl]oxy-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyne-1,14-diol |
| SMILES | C/C1=C\COCC#CCC2(O)C(=C[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)C#C1 |
| InChI | InChI=1S/C21H30O4Si/c1-16-9-10-17-15-18(22)19(25-26(5,6)20(2,3)4)21(17,23)12-7-8-13-24-14-11-16/h11,15,18-19,22-23H,12-14H2,1-6H3/b16-11+/t18-,19+,21?/m1/s1 |
| InChIKey | YQFIQUYUPPZITG-GVDIAGNASA-N |
| XLogP | 2.78 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|