C14H24O2Si — CID 11791693
(1S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol (PubChem CID 11791693) has the molecular formula C14H24O2Si and a molecular weight of 252.43 g/mol. Its IUPAC name is (1S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol.
| Compound Name | (1S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 11791693 |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (1S,4R)-4-[(2-methylpropan-2-yl)oxy]-2-(2-trimethylsilylethynyl)cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)O[C@H]1C=C(C#C[Si](C)(C)C)[C@@H](O)C1 |
| InChI | InChI=1S/C14H24O2Si/c1-14(2,3)16-12-9-11(13(15)10-12)7-8-17(4,5)6/h9,12-13,15H,10H2,1-6H3/t12-,13-/m0/s1 |
| InChIKey | FQTNTGFDNZNEFI-STQMWFEESA-N |
| XLogP | 2.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|