C13H26O3Si — CID 135017264
(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2-methylcyclopent-2-en-1-ol (PubChem CID 135017264) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is (1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2-methylcyclopent-2-en-1-ol.
| Compound Name | (1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2-methylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 135017264 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-(hydroxymethyl)-2-methylcyclopent-2-en-1-ol |
| SMILES | CC1=C[C@H](O[Si](C)(C)C(C)(C)C)C[C@]1(O)CO |
| InChI | InChI=1S/C13H26O3Si/c1-10-7-11(8-13(10,15)9-14)16-17(5,6)12(2,3)4/h7,11,14-15H,8-9H2,1-6H3/t11-,13-/m0/s1 |
| InChIKey | MLZOPGULAAFMSR-AAEUAGOBSA-N |
| XLogP | 2.45 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|