C11H22O2Si — CID 71438034
1,5-dimethyl-6-trimethylsilylcyclohex-4-ene-1,2-diol (PubChem CID 71438034) has the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. Its IUPAC name is 1,5-dimethyl-6-trimethylsilylcyclohex-4-ene-1,2-diol.
| Compound Name | 1,5-dimethyl-6-trimethylsilylcyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 71438034 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | 1,5-dimethyl-6-trimethylsilylcyclohex-4-ene-1,2-diol |
| SMILES | CC1=CCC(O)C(C)(O)C1[Si](C)(C)C |
| InChI | InChI=1S/C11H22O2Si/c1-8-6-7-9(12)11(2,13)10(8)14(3,4)5/h6,9-10,12-13H,7H2,1-5H3 |
| InChIKey | QPPIJMOYVKLLJO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|