C27H44O4Si2 — CID 139616250
(8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol (PubChem CID 139616250) has the molecular formula C27H44O4Si2 and a molecular weight of 488.82 g/mol. Its IUPAC name is (8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol.
| Compound Name | (8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol |
|---|---|
| PubChem CID | 139616250 |
| Molecular Formula | C27H44O4Si2 |
| Molecular Weight | 488.82 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | (8Z,14R,15S)-14,15-bis[[tert-butyl(dimethyl)silyl]oxy]-9-methyl-6-oxabicyclo[10.3.0]pentadeca-8,12-dien-3,10-diyn-1-ol |
| SMILES | C/C1=C\COCC#CCC2(O)C(=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)C#C1 |
| InChI | InChI=1S/C27H44O4Si2/c1-21-14-15-22-20-23(30-32(8,9)25(2,3)4)24(31-33(10,11)26(5,6)7)27(22,28)17-12-13-18-29-19-16-21/h16,20,23-24,28H,17-19H2,1-11H3/b21-16+/t23-,24+,27?/m1/s1 |
| InChIKey | DIVXBFGPPGYQMM-XCPAMVFPSA-N |
| XLogP | 5.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|