C31H52O5Si2 — CID 139616242
(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-1-prop-2-ynylcyclopent-2-en-1-ol (PubChem CID 139616242) has the molecular formula C31H52O5Si2 and a molecular weight of 560.92 g/mol. Its IUPAC name is (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-1-prop-2-ynylcyclopent-2-en-1-ol.
| Compound Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-1-prop-2-ynylcyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 139616242 |
| Molecular Formula | C31H52O5Si2 |
| Molecular Weight | 560.92 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | (4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-1-prop-2-ynylcyclopent-2-en-1-ol |
| SMILES | C#CCC1(O)C(C#C/C(C)=C\COC2CCCCO2)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H52O5Si2/c1-13-20-31(32)25(18-17-24(2)19-22-34-27-16-14-15-21-33-27)23-26(35-37(9,10)29(3,4)5)28(31)36-38(11,12)30(6,7)8/h1,19,23,26-28,32H,14-16,20-22H2,2-12H3/b24-19-/t26-,27?,28+,31?/m1/s1 |
| InChIKey | ALKRAJODUMZYNJ-LWSWXHAOSA-N |
| XLogP | 6.95 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.92 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|