C36H62O7Si2 — CID 10941382
4-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(1-ethoxyethoxy)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-yl]but-2-yn-1-ol (PubChem CID 10941382) has the molecular formula C36H62O7Si2 and a molecular weight of 663.06 g/mol. Its IUPAC name is 4-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(1-ethoxyethoxy)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-yl]but-2-yn-1-ol.
| Compound Name | 4-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(1-ethoxyethoxy)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-yl]but-2-yn-1-ol |
|---|---|
| PubChem CID | 10941382 |
| Molecular Formula | C36H62O7Si2 |
| Molecular Weight | 663.06 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | 4-[(4R,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-1-(1-ethoxyethoxy)-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]cyclopent-2-en-1-yl]but-2-yn-1-ol |
| SMILES | CCOC(C)OC1(CC#CCO)C(C#C/C(C)=C\COC2CCCCO2)=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C36H62O7Si2/c1-14-38-29(3)41-36(23-16-17-24-37)30(21-20-28(2)22-26-40-32-19-15-18-25-39-32)27-31(42-44(10,11)34(4,5)6)33(36)43-45(12,13)35(7,8)9/h22,27,29,31-33,37H,14-15,18-19,23-26H2,1-13H3/b28-22-/t29?,31-,32?,33+,36?/m1/s1 |
| InChIKey | LCZYSKQWTFUGBL-RDZDPCSSSA-N |
| XLogP | 7.72 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.06 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|