C27H44O6Si — CID 139616249
(1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-4-(oxan-2-yloxy)cyclopent-2-en-1-ol (PubChem CID 139616249) has the molecular formula C27H44O6Si and a molecular weight of 492.73 g/mol. Its IUPAC name is (1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-4-(oxan-2-yloxy)cyclopent-2-en-1-ol.
| Compound Name | (1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-4-(oxan-2-yloxy)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 139616249 |
| Molecular Formula | C27H44O6Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | (1S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-4-(oxan-2-yloxy)cyclopent-2-en-1-ol |
| SMILES | C/C(C#CC1=C[C@@H](OC2CCCCO2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1O)=C/COC1CCCCO1 |
| InChI | InChI=1S/C27H44O6Si/c1-20(15-18-31-23-11-7-9-16-29-23)13-14-21-19-22(32-24-12-8-10-17-30-24)26(25(21)28)33-34(5,6)27(2,3)4/h15,19,22-26,28H,7-12,16-18H2,1-6H3/b20-15-/t22-,23?,24?,25+,26-/m1/s1 |
| InChIKey | AUFFXKUKOHNEBX-POLGJEQOSA-N |
| XLogP | 5.08 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|