C22H34O4Si — CID 11760960
tert-butyl-dimethyl-[[(1R,2R,5R)-4-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-6-oxabicyclo[3.1.0]hex-3-en-2-yl]oxy]silane (PubChem CID 11760960) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(1R,2R,5R)-4-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-6-oxabicyclo[3.1.0]hex-3-en-2-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(1R,2R,5R)-4-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-6-oxabicyclo[3.1.0]hex-3-en-2-yl]oxy]silane |
|---|---|
| PubChem CID | 11760960 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | tert-butyl-dimethyl-[[(1R,2R,5R)-4-[(Z)-3-methyl-5-(oxan-2-yloxy)pent-3-en-1-ynyl]-6-oxabicyclo[3.1.0]hex-3-en-2-yl]oxy]silane |
| SMILES | C/C(C#CC1=C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[C@H]12)=C/COC1CCCCO1 |
| InChI | InChI=1S/C22H34O4Si/c1-16(12-14-24-19-9-7-8-13-23-19)10-11-17-15-18(21-20(17)25-21)26-27(5,6)22(2,3)4/h12,15,18-21H,7-9,13-14H2,1-6H3/b16-12-/t18-,19?,20-,21+/m1/s1 |
| InChIKey | FKKRQNHLWBKVPY-AQJYZVHUSA-N |
| XLogP | 4.58 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|