C23H44O4Si — CID 23254440
tert-butyl-[(2S,3S,4S,6R)-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane (PubChem CID 23254440) has the molecular formula C23H44O4Si and a molecular weight of 412.69 g/mol. Its IUPAC name is tert-butyl-[(2S,3S,4S,6R)-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2S,3S,4S,6R)-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 23254440 |
| Molecular Formula | C23H44O4Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | tert-butyl-[(2S,3S,4S,6R)-6-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-methoxy-2-methyloxan-3-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]1C[C@H](OC/C=C(\C)CCC=C(C)C)O[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O4Si/c1-17(2)12-11-13-18(3)14-15-25-21-16-20(24-8)22(19(4)26-21)27-28(9,10)23(5,6)7/h12,14,19-22H,11,13,15-16H2,1-10H3/b18-14+/t19-,20-,21+,22-/m0/s1 |
| InChIKey | NOYFHGMNHDYFDU-MQGCCJEUSA-N |
| XLogP | 6.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|