C22H40O7Si — CID 44598795
[(6S,6aR,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 44598795) has the molecular formula C22H40O7Si and a molecular weight of 444.64 g/mol. Its IUPAC name is [(6S,6aR,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(6S,6aR,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 44598795 |
| Molecular Formula | C22H40O7Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | [(6S,6aR,8R,9R,10aS,10bR)-8,9-dimethoxy-2,2,8,9-tetramethyl-6,6a,10a,10b-tetrahydro-4H-[1,4]dioxino[2,3-h][1,3]benzodioxin-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@]1(C)O[C@@H]2[C@@H](O[C@@]1(C)OC)[C@@H]1OC(C)(C)OCC1=C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O7Si/c1-19(2,3)30(10,11)29-15-12-14-13-25-20(4,5)26-16(14)18-17(15)27-21(6,23-8)22(7,24-9)28-18/h12,15-18H,13H2,1-11H3/t15-,16+,17-,18-,21+,22+/m0/s1 |
| InChIKey | RWIUOWHSRJXLBI-QDJVIIKBSA-N |
| XLogP | 3.98 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|