C27H52O5Si2 — CID 11005757
tert-butyl-[[(1R,10Z,12S,13R,15S)-13-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7,16-trioxatricyclo[10.3.1.04,8]hexadec-10-en-15-yl]oxy]-dimethylsilane (PubChem CID 11005757) has the molecular formula C27H52O5Si2 and a molecular weight of 512.88 g/mol. Its IUPAC name is tert-butyl-[[(1R,10Z,12S,13R,15S)-13-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7,16-trioxatricyclo[10.3.1.04,8]hexadec-10-en-15-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,10Z,12S,13R,15S)-13-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7,16-trioxatricyclo[10.3.1.04,8]hexadec-10-en-15-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11005757 |
| Molecular Formula | C27H52O5Si2 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.34 |
| IUPAC Name | tert-butyl-[[(1R,10Z,12S,13R,15S)-13-[tert-butyl(dimethyl)silyl]oxy-6,6-dimethyl-5,7,16-trioxatricyclo[10.3.1.04,8]hexadec-10-en-15-yl]oxy]-dimethylsilane |
| SMILES | CC1(C)OC2C/C=C\[C@@H]3O[C@H](CCC2O1)[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H52O5Si2/c1-25(2,3)33(9,10)31-23-18-24(32-34(11,12)26(4,5)6)20-16-17-22-21(29-27(7,8)30-22)15-13-14-19(23)28-20/h13-14,19-24H,15-18H2,1-12H3/b14-13-/t19-,20+,21?,22?,23+,24-/m0/s1 |
| InChIKey | OBBDGDKXKNJMGY-HMUAINDASA-N |
| XLogP | 7.18 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|