C26H50O4Si3 — CID 71517011
triethyl-[[(2Z,3R,4R,5S)-3-triethylsilyloxy-2-(3-trimethylsilylprop-2-ynylidene)-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane (PubChem CID 71517011) has the molecular formula C26H50O4Si3 and a molecular weight of 510.94 g/mol. Its IUPAC name is triethyl-[[(2Z,3R,4R,5S)-3-triethylsilyloxy-2-(3-trimethylsilylprop-2-ynylidene)-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane.
| Compound Name | triethyl-[[(2Z,3R,4R,5S)-3-triethylsilyloxy-2-(3-trimethylsilylprop-2-ynylidene)-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane |
|---|---|
| PubChem CID | 71517011 |
| Molecular Formula | C26H50O4Si3 |
| Molecular Weight | 510.94 g/mol |
| Exact Mass | 510.30 |
| IUPAC Name | triethyl-[[(2Z,3R,4R,5S)-3-triethylsilyloxy-2-(3-trimethylsilylprop-2-ynylidene)-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](O[Si](CC)(CC)CC)/C(=C/C#C[Si](C)(C)C)O[C@@]12CCCCO2 |
| InChI | InChI=1S/C26H50O4Si3/c1-10-32(11-2,12-3)29-24-23(19-18-22-31(7,8)9)28-26(20-16-17-21-27-26)25(24)30-33(13-4,14-5)15-6/h19,24-25H,10-17,20-21H2,1-9H3/b23-19-/t24-,25+,26-/m0/s1 |
| InChIKey | HHIDJTIIIMFLIS-PFUVVSSMSA-N |
| XLogP | 7.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.94 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|