C23H42O4Si2 — CID 71517152
triethyl-[[(2Z,3R,4R,5R)-2-prop-2-ynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane (PubChem CID 71517152) has the molecular formula C23H42O4Si2 and a molecular weight of 438.76 g/mol. Its IUPAC name is triethyl-[[(2Z,3R,4R,5R)-2-prop-2-ynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane.
| Compound Name | triethyl-[[(2Z,3R,4R,5R)-2-prop-2-ynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane |
|---|---|
| PubChem CID | 71517152 |
| Molecular Formula | C23H42O4Si2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | triethyl-[[(2Z,3R,4R,5R)-2-prop-2-ynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane |
| SMILES | C#C/C=C1\O[C@]2(CCCCO2)[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C23H42O4Si2/c1-8-17-20-21(26-28(9-2,10-3)11-4)22(27-29(12-5,13-6)14-7)23(25-20)18-15-16-19-24-23/h1,17,21-22H,9-16,18-19H2,2-7H3/b20-17-/t21-,22+,23+/m0/s1 |
| InChIKey | QXDVFJRPNBTDFH-QECVVLRRSA-N |
| XLogP | 6.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|