C26H44O4Si2 — CID 71517155
triethyl-[[(2Z,3R,4R,5S)-2-hexa-2,4-diynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane (PubChem CID 71517155) has the molecular formula C26H44O4Si2 and a molecular weight of 476.81 g/mol. Its IUPAC name is triethyl-[[(2Z,3R,4R,5S)-2-hexa-2,4-diynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane.
| Compound Name | triethyl-[[(2Z,3R,4R,5S)-2-hexa-2,4-diynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane |
|---|---|
| PubChem CID | 71517155 |
| Molecular Formula | C26H44O4Si2 |
| Molecular Weight | 476.81 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | triethyl-[[(2Z,3R,4R,5S)-2-hexa-2,4-diynylidene-3-triethylsilyloxy-1,10-dioxaspiro[4.5]decan-4-yl]oxy]silane |
| SMILES | CC#CC#C/C=C1\O[C@@]2(CCCCO2)[C@H](O[Si](CC)(CC)CC)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C26H44O4Si2/c1-8-15-16-17-20-23-24(29-31(9-2,10-3)11-4)25(30-32(12-5,13-6)14-7)26(28-23)21-18-19-22-27-26/h20,24-25H,9-14,18-19,21-22H2,1-7H3/b23-20-/t24-,25+,26-/m0/s1 |
| InChIKey | PUHMCNJEVBNRQJ-PLNHIXAUSA-N |
| XLogP | 6.60 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.81 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|