C21H36O3Si — CID 25111398
1-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]hex-5-en-3-yloxy-tert-butyl-dimethylsilane (PubChem CID 25111398) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is 1-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]hex-5-en-3-yloxy-tert-butyl-dimethylsilane.
| Compound Name | 1-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]hex-5-en-3-yloxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 25111398 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 1-[(3aR,7aS)-2,2-dimethyl-3a,7a-dihydro-1,3-benzodioxol-4-yl]hex-5-en-3-yloxy-tert-butyl-dimethylsilane |
| SMILES | C=CCC(CCC1=CC=C[C@@H]2OC(C)(C)O[C@H]12)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36O3Si/c1-9-11-17(24-25(7,8)20(2,3)4)15-14-16-12-10-13-18-19(16)23-21(5,6)22-18/h9-10,12-13,17-19H,1,11,14-15H2,2-8H3/t17?,18-,19+/m0/s1 |
| InChIKey | NCHWLJDCPYVTOC-JLMCIHFGSA-N |
| XLogP | 5.75 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|