C23H44O5Si — CID 10836308
tert-butyl-[(E)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(oxan-2-yloxy)hept-6-enoxy]-dimethylsilane (PubChem CID 10836308) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is tert-butyl-[(E)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(oxan-2-yloxy)hept-6-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(oxan-2-yloxy)hept-6-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10836308 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | tert-butyl-[(E)-7-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-5-(oxan-2-yloxy)hept-6-enoxy]-dimethylsilane |
| SMILES | CC1(C)OC[C@H](/C=C/C(CCCCO[Si](C)(C)C(C)(C)C)OC2CCCCO2)O1 |
| InChI | InChI=1S/C23H44O5Si/c1-22(2,3)29(6,7)26-17-11-8-12-19(27-21-13-9-10-16-24-21)14-15-20-18-25-23(4,5)28-20/h14-15,19-21H,8-13,16-18H2,1-7H3/b15-14+/t19?,20-,21?/m0/s1 |
| InChIKey | MZCZMFNSPUJWNA-LBCBKKCVSA-N |
| XLogP | 5.80 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|