C24H46O5Si — CID 10836941
tert-butyl-[(E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-enoxy]-dimethylsilane (PubChem CID 10836941) has the molecular formula C24H46O5Si and a molecular weight of 442.71 g/mol. Its IUPAC name is tert-butyl-[(E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10836941 |
| Molecular Formula | C24H46O5Si |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.31 |
| IUPAC Name | tert-butyl-[(E)-8-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-6-(oxan-2-yloxy)oct-7-enoxy]-dimethylsilane |
| SMILES | CC1(C)OC[C@H](/C=C/C(CCCCCO[Si](C)(C)C(C)(C)C)OC2CCCCO2)O1 |
| InChI | InChI=1S/C24H46O5Si/c1-23(2,3)30(6,7)27-18-11-8-9-13-20(28-22-14-10-12-17-25-22)15-16-21-19-26-24(4,5)29-21/h15-16,20-22H,8-14,17-19H2,1-7H3/b16-15+/t20?,21-,22?/m0/s1 |
| InChIKey | BQOYNXSNKAGFNI-FBIMEDEDSA-N |
| XLogP | 6.19 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|