C17H30O3Si — CID 11023325
[(3aR,4R,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11023325) has the molecular formula C17H30O3Si and a molecular weight of 310.51 g/mol. Its IUPAC name is [(3aR,4R,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aR,4R,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11023325 |
| Molecular Formula | C17H30O3Si |
| Molecular Weight | 310.51 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | [(3aR,4R,7aR)-6-ethenyl-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C=CC1=C[C@H]2OC(C)(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C17H30O3Si/c1-9-12-10-13-15(19-17(5,6)18-13)14(11-12)20-21(7,8)16(2,3)4/h9-10,13-15H,1,11H2,2-8H3/t13-,14-,15-/m1/s1 |
| InChIKey | LMXRIFMVVGIOJJ-RBSFLKMASA-N |
| XLogP | 4.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|