C22H40O3Si — CID 11100966
tert-butyl-[[(1S,2S,9S,10S)-10-hexyl-11,12-dioxatricyclo[7.2.1.01,6]dodec-5-en-2-yl]oxy]-dimethylsilane (PubChem CID 11100966) has the molecular formula C22H40O3Si and a molecular weight of 380.65 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,9S,10S)-10-hexyl-11,12-dioxatricyclo[7.2.1.01,6]dodec-5-en-2-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,9S,10S)-10-hexyl-11,12-dioxatricyclo[7.2.1.01,6]dodec-5-en-2-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11100966 |
| Molecular Formula | C22H40O3Si |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | tert-butyl-[[(1S,2S,9S,10S)-10-hexyl-11,12-dioxatricyclo[7.2.1.01,6]dodec-5-en-2-yl]oxy]-dimethylsilane |
| SMILES | CCCCCC[C@@H]1O[C@]23O[C@H]1CCC2=CCC[C@@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H40O3Si/c1-7-8-9-10-13-18-19-16-15-17-12-11-14-20(22(17,23-18)24-19)25-26(5,6)21(2,3)4/h12,18-20H,7-11,13-16H2,1-6H3/t18-,19-,20-,22-/m0/s1 |
| InChIKey | BTHXVWMUKGVINJ-XWUOBKMESA-N |
| XLogP | 6.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|