C21H38O4Si — CID 100926773
[(3aS,4R,7aS)-6-(2-methoxyethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 100926773) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is [(3aS,4R,7aS)-6-(2-methoxyethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4R,7aS)-6-(2-methoxyethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 100926773 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | [(3aS,4R,7aS)-6-(2-methoxyethyl)spiro[3a,4,5,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-4-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCCC1=C[C@@H]2OC3(CCCCC3)O[C@@H]2[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C21H38O4Si/c1-20(2,3)26(5,6)25-18-15-16(10-13-22-4)14-17-19(18)24-21(23-17)11-8-7-9-12-21/h14,17-19H,7-13,15H2,1-6H3/t17-,18+,19-/m0/s1 |
| InChIKey | KDSQCKUWDUTUJW-OTWHNJEPSA-N |
| XLogP | 5.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|