C26H36O4Si — CID 10026281
tert-butyl-[(2R,5Z,9S,10S,14S)-2-methoxyspiro[11,13-dioxatricyclo[7.6.1.010,14]hexadeca-1(15),5-dien-3,7-diyne-12,1'-cyclohexane]-9-yl]oxy-dimethylsilane (PubChem CID 10026281) has the molecular formula C26H36O4Si and a molecular weight of 440.66 g/mol. Its IUPAC name is tert-butyl-[(2R,5Z,9S,10S,14S)-2-methoxyspiro[11,13-dioxatricyclo[7.6.1.010,14]hexadeca-1(15),5-dien-3,7-diyne-12,1'-cyclohexane]-9-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,5Z,9S,10S,14S)-2-methoxyspiro[11,13-dioxatricyclo[7.6.1.010,14]hexadeca-1(15),5-dien-3,7-diyne-12,1'-cyclohexane]-9-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 10026281 |
| Molecular Formula | C26H36O4Si |
| Molecular Weight | 440.66 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | tert-butyl-[(2R,5Z,9S,10S,14S)-2-methoxyspiro[11,13-dioxatricyclo[7.6.1.010,14]hexadeca-1(15),5-dien-3,7-diyne-12,1'-cyclohexane]-9-yl]oxy-dimethylsilane |
| SMILES | CO[C@H]1C#C/C=C\C#C[C@@]2(O[Si](C)(C)C(C)(C)C)CC1=C[C@@H]1OC3(CCCCC3)O[C@@H]12 |
| InChI | InChI=1S/C26H36O4Si/c1-24(2,3)31(5,6)30-25-15-11-8-7-10-14-21(27-4)20(19-25)18-22-23(25)29-26(28-22)16-12-9-13-17-26/h7-8,18,21-23H,9,12-13,16-17,19H2,1-6H3/b8-7-/t21-,22-,23-,25+/m0/s1 |
| InChIKey | OPLDLQSQLYBPQI-WGDXCYAMSA-N |
| XLogP | 5.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.66 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|