C20H32O5Si — CID 100926781
(3aS,4R,7S,7aS)-5-(2-methoxyethyl)-7-(2-trimethylsilylethynyl)spiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4,7-diol (PubChem CID 100926781) has the molecular formula C20H32O5Si and a molecular weight of 380.56 g/mol. Its IUPAC name is (3aS,4R,7S,7aS)-5-(2-methoxyethyl)-7-(2-trimethylsilylethynyl)spiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4,7-diol.
| Compound Name | (3aS,4R,7S,7aS)-5-(2-methoxyethyl)-7-(2-trimethylsilylethynyl)spiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4,7-diol |
|---|---|
| PubChem CID | 100926781 |
| Molecular Formula | C20H32O5Si |
| Molecular Weight | 380.56 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (3aS,4R,7S,7aS)-5-(2-methoxyethyl)-7-(2-trimethylsilylethynyl)spiro[4,7a-dihydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-4,7-diol |
| SMILES | COCCC1=C[C@](O)(C#C[Si](C)(C)C)[C@H]2OC3(CCCCC3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C20H32O5Si/c1-23-12-8-15-14-19(22,11-13-26(2,3)4)18-17(16(15)21)24-20(25-18)9-6-5-7-10-20/h14,16-18,21-22H,5-10,12H2,1-4H3/t16-,17+,18+,19-/m1/s1 |
| InChIKey | ZRDRXIQCIOIPOQ-YDZRNGNQSA-N |
| XLogP | 2.38 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|