C19H34O5Si — CID 101465399
(8aS)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[1,2,3,5,6,7-hexahydronaphthalene-8,2'-1,3-dioxolane]-2,3-diol (PubChem CID 101465399) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is (8aS)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[1,2,3,5,6,7-hexahydronaphthalene-8,2'-1,3-dioxolane]-2,3-diol.
| Compound Name | (8aS)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[1,2,3,5,6,7-hexahydronaphthalene-8,2'-1,3-dioxolane]-2,3-diol |
|---|---|
| PubChem CID | 101465399 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (8aS)-8a-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[1,2,3,5,6,7-hexahydronaphthalene-8,2'-1,3-dioxolane]-2,3-diol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@]12CC(O)C(O)C=C1CCCC21OCCO1 |
| InChI | InChI=1S/C19H34O5Si/c1-17(2,3)25(4,5)24-13-18-12-16(21)15(20)11-14(18)7-6-8-19(18)22-9-10-23-19/h11,15-16,20-21H,6-10,12-13H2,1-5H3/t15?,16?,18-/m1/s1 |
| InChIKey | ZDWPIACTJOXLBS-LEOMRAHMSA-N |
| XLogP | 2.97 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|