C19H34O4Si — CID 100926778
[(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol (PubChem CID 100926778) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is [(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol.
| Compound Name | [(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol |
|---|---|
| PubChem CID | 100926778 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | [(3aS,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxyspiro[3a,6,7,7a-tetrahydro-1,3-benzodioxole-2,1'-cyclohexane]-5-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC(CO)=C[C@@H]2OC3(CCCCC3)O[C@@H]21 |
| InChI | InChI=1S/C19H34O4Si/c1-18(2,3)24(4,5)23-16-12-14(13-20)11-15-17(16)22-19(21-15)9-7-6-8-10-19/h11,15-17,20H,6-10,12-13H2,1-5H3/t15-,16+,17-/m0/s1 |
| InChIKey | QWQQZBYFEIWXHZ-BBWFWOEESA-N |
| XLogP | 4.14 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|