C32H56O5Si — CID 10973645
(2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol (PubChem CID 10973645) has the molecular formula C32H56O5Si and a molecular weight of 548.88 g/mol. Its IUPAC name is (2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol.
| Compound Name | (2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol |
|---|---|
| PubChem CID | 10973645 |
| Molecular Formula | C32H56O5Si |
| Molecular Weight | 548.88 g/mol |
| Exact Mass | 548.39 |
| IUPAC Name | (2S,3S,4E,6E)-8-[(2R,5S,8S,9R)-2-butyl-2-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyprop-2-ynyl]-8-methyl-1,10-dioxaspiro[4.5]decan-9-yl]-2,6-dimethylocta-4,6-diene-1,3-diol |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(CCCC)CC[C@]2(CC[C@H](C)[C@@H](C/C=C(C)/C=C/[C@H](O)[C@@H](C)CO)O2)O1 |
| InChI | InChI=1S/C32H56O5Si/c1-11-13-19-31(29(12-2)36-38(9,10)30(6,7)8)21-22-32(37-31)20-18-25(4)28(35-32)17-15-24(3)14-16-27(34)26(5)23-33/h2,14-16,25-29,33-34H,11,13,17-23H2,1,3-10H3/b16-14+,24-15+/t25-,26-,27-,28+,29-,31+,32-/m0/s1 |
| InChIKey | ZNFMBONKGXECRL-RPUFLPBBSA-N |
| XLogP | 7.14 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.88 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|