C19H32O6Si — CID 162406230
[(1R,5R,7R,8R)-8-(methoxymethoxy)-7-(methoxymethoxymethyl)-7-methyl-5-(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]oct-3-en-4-yl]methanol (PubChem CID 162406230) has the molecular formula C19H32O6Si and a molecular weight of 384.55 g/mol. Its IUPAC name is [(1R,5R,7R,8R)-8-(methoxymethoxy)-7-(methoxymethoxymethyl)-7-methyl-5-(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]oct-3-en-4-yl]methanol.
| Compound Name | [(1R,5R,7R,8R)-8-(methoxymethoxy)-7-(methoxymethoxymethyl)-7-methyl-5-(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]oct-3-en-4-yl]methanol |
|---|---|
| PubChem CID | 162406230 |
| Molecular Formula | C19H32O6Si |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | [(1R,5R,7R,8R)-8-(methoxymethoxy)-7-(methoxymethoxymethyl)-7-methyl-5-(2-trimethylsilylethynyl)-6-oxabicyclo[3.2.1]oct-3-en-4-yl]methanol |
| SMILES | COCOC[C@]1(C)O[C@@]2(C#C[Si](C)(C)C)C(CO)=CC[C@@H]1[C@H]2OCOC |
| InChI | InChI=1S/C19H32O6Si/c1-18(12-23-13-21-2)16-8-7-15(11-20)19(25-18,9-10-26(4,5)6)17(16)24-14-22-3/h7,16-17,20H,8,11-14H2,1-6H3/t16-,17-,18+,19+/m1/s1 |
| InChIKey | NFPIJNZEXBTHLN-YRXWBPOGSA-N |
| XLogP | 1.94 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|