C19H30O4Si — CID 11667465
(1S,2S)-1-(methoxymethoxy)-1-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 11667465) has the molecular formula C19H30O4Si and a molecular weight of 350.53 g/mol. Its IUPAC name is (1S,2S)-1-(methoxymethoxy)-1-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (1S,2S)-1-(methoxymethoxy)-1-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 11667465 |
| Molecular Formula | C19H30O4Si |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (1S,2S)-1-(methoxymethoxy)-1-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | COCO[C@@H]([C@@H]1[C@H](C)[C@H]2C=CC=C[C@@H]1O2)[C@@H](O)CC#C[Si](C)(C)C |
| InChI | InChI=1S/C19H30O4Si/c1-14-16-10-6-7-11-17(23-16)18(14)19(22-13-21-2)15(20)9-8-12-24(3,4)5/h6-7,10-11,14-20H,9,13H2,1-5H3/t14-,15+,16-,17+,18-,19-/m1/s1 |
| InChIKey | AWYLVDOWEPUVLI-JWXAEQQXSA-N |
| XLogP | 2.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|