C20H32O4Si — CID 11268541
(2S,3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-ol (PubChem CID 11268541) has the molecular formula C20H32O4Si and a molecular weight of 364.56 g/mol. Its IUPAC name is (2S,3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-ol.
| Compound Name | (2S,3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-ol |
|---|---|
| PubChem CID | 11268541 |
| Molecular Formula | C20H32O4Si |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | (2S,3R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-ol |
| SMILES | C[C@H]1[C@@H]([C@@H]2O[C@@H](O[Si](C)(C)C(C)(C)C)C=C[C@H]2O)[C@@H]2C=CC=C[C@H]1O2 |
| InChI | InChI=1S/C20H32O4Si/c1-13-15-9-7-8-10-16(22-15)18(13)19-14(21)11-12-17(23-19)24-25(5,6)20(2,3)4/h7-19,21H,1-6H3/t13-,14-,15-,16+,17+,18-,19-/m1/s1 |
| InChIKey | VRMADBXTNUGLDV-NPAXRPIGSA-N |
| XLogP | 3.80 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|