C22H34O5Si — CID 11188973
[(2S,3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-yl] acetate (PubChem CID 11188973) has the molecular formula C22H34O5Si and a molecular weight of 406.60 g/mol. Its IUPAC name is [(2S,3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-yl] acetate.
| Compound Name | [(2S,3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-yl] acetate |
|---|---|
| PubChem CID | 11188973 |
| Molecular Formula | C22H34O5Si |
| Molecular Weight | 406.60 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | [(2S,3S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,6S,7R,8S)-8-methyl-9-oxabicyclo[4.2.1]nona-2,4-dien-7-yl]-3,6-dihydro-2H-pyran-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C[C@@H](O[Si](C)(C)C(C)(C)C)O[C@H]1[C@@H]1[C@H](C)[C@H]2C=CC=C[C@@H]1O2 |
| InChI | InChI=1S/C22H34O5Si/c1-14-16-10-8-9-11-17(25-16)20(14)21-18(24-15(2)23)12-13-19(26-21)27-28(6,7)22(3,4)5/h8-14,16-21H,1-7H3/t14-,16-,17+,18+,19-,20-,21-/m1/s1 |
| InChIKey | WRHLYSFWGSQNHC-HVZDBWIMSA-N |
| XLogP | 4.37 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|