C18H32O5Si — CID 11121844
[(1R,2S,4S,6R,8S)-2-[diethyl(propan-2-yl)silyl]oxy-4-methoxy-5,7-dioxatricyclo[6.2.1.02,6]undec-9-en-10-yl]methanol (PubChem CID 11121844) has the molecular formula C18H32O5Si and a molecular weight of 356.54 g/mol. Its IUPAC name is [(1R,2S,4S,6R,8S)-2-[diethyl(propan-2-yl)silyl]oxy-4-methoxy-5,7-dioxatricyclo[6.2.1.02,6]undec-9-en-10-yl]methanol.
| Compound Name | [(1R,2S,4S,6R,8S)-2-[diethyl(propan-2-yl)silyl]oxy-4-methoxy-5,7-dioxatricyclo[6.2.1.02,6]undec-9-en-10-yl]methanol |
|---|---|
| PubChem CID | 11121844 |
| Molecular Formula | C18H32O5Si |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | [(1R,2S,4S,6R,8S)-2-[diethyl(propan-2-yl)silyl]oxy-4-methoxy-5,7-dioxatricyclo[6.2.1.02,6]undec-9-en-10-yl]methanol |
| SMILES | CC[Si](CC)(O[C@]12C[C@@H](OC)O[C@H]1O[C@@H]1C=C(CO)[C@H]2C1)C(C)C |
| InChI | InChI=1S/C18H32O5Si/c1-6-24(7-2,12(3)4)23-18-10-16(20-5)22-17(18)21-14-8-13(11-19)15(18)9-14/h8,12,14-17,19H,6-7,9-11H2,1-5H3/t14-,15-,16+,17-,18+/m1/s1 |
| InChIKey | WOAVCLATFVOUFB-SFFUCWETSA-N |
| XLogP | 3.19 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|