C25H46O7Si — CID 10874583
(4S)-4-[(2R,3S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methyloxan-2-yl]-2-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-1-en-3-ol (PubChem CID 10874583) has the molecular formula C25H46O7Si and a molecular weight of 486.72 g/mol. Its IUPAC name is (4S)-4-[(2R,3S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methyloxan-2-yl]-2-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-1-en-3-ol.
| Compound Name | (4S)-4-[(2R,3S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methyloxan-2-yl]-2-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-1-en-3-ol |
|---|---|
| PubChem CID | 10874583 |
| Molecular Formula | C25H46O7Si |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | (4S)-4-[(2R,3S,5S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-methyloxan-2-yl]-2-[(2S,3S,6R)-3,6-dimethoxy-3,6-dihydro-2H-pyran-2-yl]pent-1-en-3-ol |
| SMILES | C=C(C(O)[C@H](C)[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@@H]1OC)[C@@H]1O[C@@H](OC)C=C[C@@H]1OC |
| InChI | InChI=1S/C25H46O7Si/c1-15-14-19(28-8)23(31-24(15)32-33(10,11)25(4,5)6)17(3)21(26)16(2)22-18(27-7)12-13-20(29-9)30-22/h12-13,15,17-24,26H,2,14H2,1,3-11H3/t15-,17-,18-,19-,20+,21?,22-,23+,24+/m0/s1 |
| InChIKey | BKFQZTHJOHSVSO-XVNOZPIWSA-N |
| XLogP | 4.27 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|