C23H40O6Si — CID 11597377
CID 11597377 (PubChem CID 11597377) has the molecular formula C23H40O6Si and a molecular weight of 440.65 g/mol.
| Compound Name | CID 11597377 |
|---|---|
| PubChem CID | 11597377 |
| Molecular Formula | C23H40O6Si |
| Molecular Weight | 440.65 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2OC(O)C[C@H]2O[C@@]12CC[C@]1(CC=C[C@@H](CCO[Si](C)(C)C(C)(C)C)O1)O2 |
| InChI | InChI=1S/C23H40O6Si/c1-16-14-18-19(15-20(24)26-18)28-23(16)12-11-22(29-23)10-7-8-17(27-22)9-13-25-30(5,6)21(2,3)4/h7-8,16-20,24H,9-15H2,1-6H3/t16-,17+,18-,19-,20?,22+,23-/m1/s1 |
| InChIKey | WGZIRLMWNLGUJS-QSLIQFLESA-N |
| XLogP | 4.48 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|