C22H42O7Si — CID 138985050
[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]methanol (PubChem CID 138985050) has the molecular formula C22H42O7Si and a molecular weight of 446.66 g/mol. Its IUPAC name is [(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]methanol.
| Compound Name | [(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 138985050 |
| Molecular Formula | C22H42O7Si |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]methanol |
| SMILES | COCO[C@H](/C=C/[C@H](C)CC1OCCO1)[C@@H]1O[C@@H](CO)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H42O7Si/c1-16(12-20-25-10-11-26-20)8-9-18(27-15-24-5)21-19(13-17(14-23)28-21)29-30(6,7)22(2,3)4/h8-9,16-21,23H,10-15H2,1-7H3/b9-8+/t16-,17+,18+,19-,21-/m0/s1 |
| InChIKey | ISMKQSWMJFIBBQ-AZPRWWGASA-N |
| XLogP | 3.47 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|