C27H50O7Si2 — CID 138985048
(1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 138985048) has the molecular formula C27H50O7Si2 and a molecular weight of 542.86 g/mol. Its IUPAC name is (1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 138985048 |
| Molecular Formula | C27H50O7Si2 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | (1R)-1-[(2R,4S,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(E,1R,4R)-5-(1,3-dioxolan-2-yl)-1-(methoxymethoxy)-4-methylpent-2-enyl]oxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | COCO[C@H](/C=C/[C@H](C)CC1OCCO1)[C@@H]1O[C@@H]([C@H](O)C#C[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H50O7Si2/c1-20(17-25-30-14-15-31-25)11-12-22(32-19-29-5)26-24(34-36(9,10)27(2,3)4)18-23(33-26)21(28)13-16-35(6,7)8/h11-12,20-26,28H,14-15,17-19H2,1-10H3/b12-11+/t20-,21+,22+,23+,24-,26-/m0/s1 |
| InChIKey | DUBASQJCGDIQRO-PGLPAKHTSA-N |
| XLogP | 4.72 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|