C25H44O7Si — CID 135073251
(3R,5R,6Z)-6-[(3aR,5S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-1-en-3-ol (PubChem CID 135073251) has the molecular formula C25H44O7Si and a molecular weight of 484.71 g/mol. Its IUPAC name is (3R,5R,6Z)-6-[(3aR,5S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-1-en-3-ol.
| Compound Name | (3R,5R,6Z)-6-[(3aR,5S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-1-en-3-ol |
|---|---|
| PubChem CID | 135073251 |
| Molecular Formula | C25H44O7Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | (3R,5R,6Z)-6-[(3aR,5S,6aR)-5-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]-5-[tert-butyl(dimethyl)silyl]oxy-3-methylhex-1-en-3-ol |
| SMILES | C=C[C@](C)(O)C[C@H](/C=C1\[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@@H]1COC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H44O7Si/c1-12-25(9,26)14-16(32-33(10,11)22(2,3)4)13-17-19(18-15-27-23(5,6)29-18)28-21-20(17)30-24(7,8)31-21/h12-13,16,18-21,26H,1,14-15H2,2-11H3/b17-13-/t16-,18-,19-,20+,21+,25-/m0/s1 |
| InChIKey | JIAUALOHZGCDCJ-MFBLHKTJSA-N |
| XLogP | 4.66 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|