C16H27FO5Si — CID 71114631
(1R,2R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-10-fluoro-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-1-ol (PubChem CID 71114631) has the molecular formula C16H27FO5Si and a molecular weight of 346.47 g/mol. Its IUPAC name is (1R,2R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-10-fluoro-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-1-ol.
| Compound Name | (1R,2R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-10-fluoro-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-1-ol |
|---|---|
| PubChem CID | 71114631 |
| Molecular Formula | C16H27FO5Si |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (1R,2R,6R,9S)-9-[tert-butyl(dimethyl)silyl]oxy-10-fluoro-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-en-1-ol |
| SMILES | CC1(C)O[C@H]2OC3[C@H](O[Si](C)(C)C(C)(C)C)C(F)=C[C@]3(O)[C@H]2O1 |
| InChI | InChI=1S/C16H27FO5Si/c1-14(2,3)23(6,7)22-10-9(17)8-16(18)11(10)19-13-12(16)20-15(4,5)21-13/h8,10-13,18H,1-7H3/t10-,11?,12+,13-,16-/m1/s1 |
| InChIKey | GNYLJWBUNARSAO-VYPUVKRYSA-N |
| XLogP | 2.85 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|