C10H14O5 — CID 10680118
(1R,2R,6R,8R,9S)-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-ene-1,9-diol (PubChem CID 10680118) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (1R,2R,6R,8R,9S)-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-ene-1,9-diol.
| Compound Name | (1R,2R,6R,8R,9S)-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-ene-1,9-diol |
|---|---|
| PubChem CID | 10680118 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (1R,2R,6R,8R,9S)-4,4-dimethyl-3,5,7-trioxatricyclo[6.3.0.02,6]undec-10-ene-1,9-diol |
| SMILES | CC1(C)O[C@H]2O[C@@H]3[C@@H](O)C=C[C@]3(O)[C@H]2O1 |
| InChI | InChI=1S/C10H14O5/c1-9(2)14-7-8(15-9)13-6-5(11)3-4-10(6,7)12/h3-8,11-12H,1-2H3/t5-,6+,7-,8+,10+/m0/s1 |
| InChIKey | HPKWHAUXUIUBOE-RZWYQDGFSA-N |
| XLogP | -0.48 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|