C13H22O5 — CID 101244428
(2R,3R,3aR,4R,5R,6aS)-2-ethyl-5-[(E)-3-hydroxyprop-1-enyl]-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-3,4-diol (PubChem CID 101244428) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is (2R,3R,3aR,4R,5R,6aS)-2-ethyl-5-[(E)-3-hydroxyprop-1-enyl]-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-3,4-diol.
| Compound Name | (2R,3R,3aR,4R,5R,6aS)-2-ethyl-5-[(E)-3-hydroxyprop-1-enyl]-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-3,4-diol |
|---|---|
| PubChem CID | 101244428 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | (2R,3R,3aR,4R,5R,6aS)-2-ethyl-5-[(E)-3-hydroxyprop-1-enyl]-3,3a-dimethyl-2,4,5,6a-tetrahydrofuro[2,3-b]furan-3,4-diol |
| SMILES | CC[C@H]1O[C@@H]2O[C@H](/C=C/CO)[C@H](O)[C@]2(C)[C@@]1(C)O |
| InChI | InChI=1S/C13H22O5/c1-4-9-13(3,16)12(2)10(15)8(6-5-7-14)17-11(12)18-9/h5-6,8-11,14-16H,4,7H2,1-3H3/b6-5+/t8-,9-,10+,11+,12+,13+/m1/s1 |
| InChIKey | KPPQTXQSUHNEGW-QKIHEREWSA-N |
| XLogP | 0.19 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|