C14H20O6 — CID 135062733
(3aR,4aR,5R,8aR,8bR)-8a-(methoxymethoxy)-2,2-dimethyl-8-methylidene-3a,4a,5,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-5-ol (PubChem CID 135062733) has the molecular formula C14H20O6 and a molecular weight of 284.31 g/mol. Its IUPAC name is (3aR,4aR,5R,8aR,8bR)-8a-(methoxymethoxy)-2,2-dimethyl-8-methylidene-3a,4a,5,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-5-ol.
| Compound Name | (3aR,4aR,5R,8aR,8bR)-8a-(methoxymethoxy)-2,2-dimethyl-8-methylidene-3a,4a,5,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-5-ol |
|---|---|
| PubChem CID | 135062733 |
| Molecular Formula | C14H20O6 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | (3aR,4aR,5R,8aR,8bR)-8a-(methoxymethoxy)-2,2-dimethyl-8-methylidene-3a,4a,5,8b-tetrahydro-[1,3]dioxolo[4,5-b][1]benzofuran-5-ol |
| SMILES | C=C1C=C[C@@H](O)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@@]12OCOC |
| InChI | InChI=1S/C14H20O6/c1-8-5-6-9(15)10-14(8,17-7-16-4)11-12(18-10)20-13(2,3)19-11/h5-6,9-12,15H,1,7H2,2-4H3/t9-,10-,11+,12-,14-/m1/s1 |
| InChIKey | NAJFPOSJDSRGKB-YGEZULPYSA-N |
| XLogP | 0.71 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|