C13H18O4 — CID 11195763
(1R,2R,6R,8R)-9-ethenyl-1,4,4-trimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene (PubChem CID 11195763) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1R,2R,6R,8R)-9-ethenyl-1,4,4-trimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene.
| Compound Name | (1R,2R,6R,8R)-9-ethenyl-1,4,4-trimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene |
|---|---|
| PubChem CID | 11195763 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1R,2R,6R,8R)-9-ethenyl-1,4,4-trimethyl-3,5,7,12-tetraoxatricyclo[6.4.0.02,6]dodec-9-ene |
| SMILES | C=CC1=CCO[C@]2(C)[C@@H]1O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C13H18O4/c1-5-8-6-7-14-13(4)9(8)15-11-10(13)16-12(2,3)17-11/h5-6,9-11H,1,7H2,2-4H3/t9-,10+,11-,13-/m1/s1 |
| InChIKey | ICCDDFBIMULOEL-LSCVPOLPSA-N |
| XLogP | 1.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |