C14H20O3 — CID 57393072
(3aS,9aS)-2-methyl-2-prop-2-enoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 57393072) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (3aS,9aS)-2-methyl-2-prop-2-enoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (3aS,9aS)-2-methyl-2-prop-2-enoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 57393072 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (3aS,9aS)-2-methyl-2-prop-2-enoxy-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | C=CCOC1(C)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C14H20O3/c1-3-8-16-13(2)9-12-14(17-13)7-5-4-6-11(14)10-15-12/h3,6,12H,1,4-5,7-10H2,2H3/t12-,13?,14-/m0/s1 |
| InChIKey | VHJCLFGFTXILCT-HPNRGHHYSA-N |
| XLogP | 2.57 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|