C16H24O3 — CID 57393071
(3aS,9aS)-2-methyl-2-(3-methylbut-2-enoxy)-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran (PubChem CID 57393071) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (3aS,9aS)-2-methyl-2-(3-methylbut-2-enoxy)-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran.
| Compound Name | (3aS,9aS)-2-methyl-2-(3-methylbut-2-enoxy)-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
|---|---|
| PubChem CID | 57393071 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (3aS,9aS)-2-methyl-2-(3-methylbut-2-enoxy)-3,3a,5,7,8,9-hexahydrofuro[2,3-i][2]benzofuran |
| SMILES | CC(C)=CCOC1(C)C[C@@H]2OCC3=CCCC[C@]32O1 |
| InChI | InChI=1S/C16H24O3/c1-12(2)7-9-18-15(3)10-14-16(19-15)8-5-4-6-13(16)11-17-14/h6-7,14H,4-5,8-11H2,1-3H3/t14-,15?,16-/m0/s1 |
| InChIKey | XJEFARKENJVYDZ-AQOJYXMDSA-N |
| XLogP | 3.35 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|